C20H27BrFN7O4 — CID 143754276
6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-bromo-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;[(2R)-1,4-dioxan-2-yl]methanol (PubChem CID 143754276) has the molecular formula C20H27BrFN7O4 and a molecular weight of 528.38 g/mol. Its IUPAC name is 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-bromo-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;[(2R)-1,4-dioxan-2-yl]methanol.
| Compound Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-bromo-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;[(2R)-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 143754276 |
| Molecular Formula | C20H27BrFN7O4 |
| Molecular Weight | 528.38 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-bromo-4-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide;[(2R)-1,4-dioxan-2-yl]methanol |
| SMILES | Cc1nc(C(=O)NCc2ccc(F)c(Br)c2)cc(/C(N)=N/N(C)N)n1.OC[C@@H]1COCCO1 |
| InChI | InChI=1S/C15H17BrFN7O.C5H10O3/c1-8-21-12(14(18)23-24(2)19)6-13(22-8)15(25)20-7-9-3-4-11(17)10(16)5-9;6-3-5-4-7-1-2-8-5/h3-6H,7,19H2,1-2H3,(H2,18,23)(H,20,25);5-6H,1-4H2/t;5-/m.1/s1 |
| InChIKey | BGECUMYHTRCNFV-QDXATWJZSA-N |
| XLogP | 0.44 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|