C24H35N7O4 — CID 143754043
6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide;methyl cyclohexanecarboxylate (PubChem CID 143754043) has the molecular formula C24H35N7O4 and a molecular weight of 485.59 g/mol. Its IUPAC name is 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide;methyl cyclohexanecarboxylate.
| Compound Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide;methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 143754043 |
| Molecular Formula | C24H35N7O4 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-N-[(3-methoxyphenyl)methyl]-2-methylpyrimidine-4-carboxamide;methyl cyclohexanecarboxylate |
| SMILES | COC(=O)C1CCCCC1.COc1cccc(CNC(=O)c2cc(/C(N)=N/N(C)N)nc(C)n2)c1 |
| InChI | InChI=1S/C16H21N7O2.C8H14O2/c1-10-20-13(15(17)22-23(2)18)8-14(21-10)16(24)19-9-11-5-4-6-12(7-11)25-3;1-10-8(9)7-5-3-2-4-6-7/h4-8H,9,18H2,1-3H3,(H2,17,22)(H,19,24);7H,2-6H2,1H3 |
| InChIKey | UXTAPHQRCFFZFM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|