C17H20N10O — CID 143756584
N-[2-(2-hydrazinylethoxy)-4-pyridinyl]-3-[1-(methylamino)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143756584) has the molecular formula C17H20N10O and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[2-(2-hydrazinylethoxy)-4-pyridinyl]-3-[1-(methylamino)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[2-(2-hydrazinylethoxy)-4-pyridinyl]-3-[1-(methylamino)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143756584 |
| Molecular Formula | C17H20N10O |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[2-(2-hydrazinylethoxy)-4-pyridinyl]-3-[1-(methylamino)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CNn1cc(-c2cnc3c(Nc4ccnc(OCCNN)c4)nccn23)cn1 |
| InChI | InChI=1S/C17H20N10O/c1-19-27-11-12(9-24-27)14-10-22-17-16(21-4-6-26(14)17)25-13-2-3-20-15(8-13)28-7-5-23-18/h2-4,6,8-11,19,23H,5,7,18H2,1H3,(H,20,21,25) |
| InChIKey | YSLYCYDIYVCVJQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|