C10H16N2 — CID 143758508
(3Z)-N,N-diethyl-3-ethylidenepyrrol-2-amine (PubChem CID 143758508) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3Z)-N,N-diethyl-3-ethylidenepyrrol-2-amine.
| Compound Name | (3Z)-N,N-diethyl-3-ethylidenepyrrol-2-amine |
|---|---|
| PubChem CID | 143758508 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3Z)-N,N-diethyl-3-ethylidenepyrrol-2-amine |
| SMILES | C/C=C1/C=CN=C1N(CC)CC |
| InChI | InChI=1S/C10H16N2/c1-4-9-7-8-11-10(9)12(5-2)6-3/h4,7-8H,5-6H2,1-3H3/b9-4- |
| InChIKey | ZIBXJWWAPFILCH-WTKPLQERSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |