C21H26N2O2S — CID 143759202
tert-butyl [4-(3,4-dimethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]sulfanylformate (PubChem CID 143759202) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is tert-butyl [4-(3,4-dimethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]sulfanylformate.
| Compound Name | tert-butyl [4-(3,4-dimethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]sulfanylformate |
|---|---|
| PubChem CID | 143759202 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl [4-(3,4-dimethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl]sulfanylformate |
| SMILES | Cc1ccc(Nc2ccnc3c2CCC3SC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C21H26N2O2S/c1-13-6-7-15(12-14(13)2)23-17-10-11-22-19-16(17)8-9-18(19)26-20(24)25-21(3,4)5/h6-7,10-12,18H,8-9H2,1-5H3,(H,22,23) |
| InChIKey | RLYGAFDQPRTRTK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|