C24H29N3O5S3 — CID 143759299
2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-4-[(4-methyl-3-sulfanyloxyphenyl)methyl]-1,3-thiazole;ethane (PubChem CID 143759299) has the molecular formula C24H29N3O5S3 and a molecular weight of 535.71 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-4-[(4-methyl-3-sulfanyloxyphenyl)methyl]-1,3-thiazole;ethane.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-4-[(4-methyl-3-sulfanyloxyphenyl)methyl]-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 143759299 |
| Molecular Formula | C24H29N3O5S3 |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-4-[(4-methyl-3-sulfanyloxyphenyl)methyl]-1,3-thiazole;ethane |
| SMILES | CC.Cc1ccc(Cc2csc(N3CCN(S(=O)(=O)c4ccc5c(c4)OCO5)CC3)n2)cc1OS |
| InChI | InChI=1S/C22H23N3O5S3.C2H6/c1-15-2-3-16(11-20(15)30-31)10-17-13-32-22(23-17)24-6-8-25(9-7-24)33(26,27)18-4-5-19-21(12-18)29-14-28-19;1-2/h2-5,11-13,31H,6-10,14H2,1H3;1-2H3 |
| InChIKey | ALSWEOYATOERLS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|