C9H15F6NO — CID 143759756
1,1,1,3,3,3-hexafluoro-2-methoxypropane;piperidine (PubChem CID 143759756) has the molecular formula C9H15F6NO and a molecular weight of 267.21 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-methoxypropane;piperidine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-methoxypropane;piperidine |
|---|---|
| PubChem CID | 143759756 |
| Molecular Formula | C9H15F6NO |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-methoxypropane;piperidine |
| SMILES | C1CCNCC1.COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H11N.C4H4F6O/c1-2-4-6-5-3-1;1-11-2(3(5,6)7)4(8,9)10/h6H,1-5H2;2H,1H3 |
| InChIKey | ZFCSDONFIIUNEY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |