C20H27N3O3 — CID 143759853
2,3-dihydro-1,4-benzoxazine-4-carboxamide;1-(nitrosomethyl)adamantane (PubChem CID 143759853) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxazine-4-carboxamide;1-(nitrosomethyl)adamantane.
| Compound Name | 2,3-dihydro-1,4-benzoxazine-4-carboxamide;1-(nitrosomethyl)adamantane |
|---|---|
| PubChem CID | 143759853 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxazine-4-carboxamide;1-(nitrosomethyl)adamantane |
| SMILES | NC(=O)N1CCOc2ccccc21.O=NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H17NO.C9H10N2O2/c13-12-7-11-4-8-1-9(5-11)3-10(2-8)6-11;10-9(12)11-5-6-13-8-4-2-1-3-7(8)11/h8-10H,1-7H2;1-4H,5-6H2,(H2,10,12) |
| InChIKey | PXGBGFGPBBPMQV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |