C23H14O5 — CID 143760701
4,5,6-trihydroxy-9-naphthalen-2-ylxanthen-3-one (PubChem CID 143760701) has the molecular formula C23H14O5 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4,5,6-trihydroxy-9-naphthalen-2-ylxanthen-3-one.
| Compound Name | 4,5,6-trihydroxy-9-naphthalen-2-ylxanthen-3-one |
|---|---|
| PubChem CID | 143760701 |
| Molecular Formula | C23H14O5 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4,5,6-trihydroxy-9-naphthalen-2-ylxanthen-3-one |
| SMILES | O=c1ccc2c(-c3ccc4ccccc4c3)c3ccc(O)c(O)c3oc-2c1O |
| InChI | InChI=1S/C23H14O5/c24-17-9-7-15-19(14-6-5-12-3-1-2-4-13(12)11-14)16-8-10-18(25)21(27)23(16)28-22(15)20(17)26/h1-11,24,26-27H |
| InChIKey | IUAUUULXZHSABI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|