C29H27F3N2O3 — CID 143762034
2-[[[5-[2-(2,5-dimethylphenyl)ethynyl]-2-(trifluoromethoxy)phenyl]-hydroxymethyl]amino]-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 143762034) has the molecular formula C29H27F3N2O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is 2-[[[5-[2-(2,5-dimethylphenyl)ethynyl]-2-(trifluoromethoxy)phenyl]-hydroxymethyl]amino]-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | 2-[[[5-[2-(2,5-dimethylphenyl)ethynyl]-2-(trifluoromethoxy)phenyl]-hydroxymethyl]amino]-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 143762034 |
| Molecular Formula | C29H27F3N2O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-[[[5-[2-(2,5-dimethylphenyl)ethynyl]-2-(trifluoromethoxy)phenyl]-hydroxymethyl]amino]-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | Cc1ccc(C)c(C#Cc2ccc(OC(F)(F)F)c(C(O)NC(CO)Cc3c[nH]c4ccccc34)c2)c1 |
| InChI | InChI=1S/C29H27F3N2O3/c1-18-7-8-19(2)21(13-18)11-9-20-10-12-27(37-29(30,31)32)25(14-20)28(36)34-23(17-35)15-22-16-33-26-6-4-3-5-24(22)26/h3-8,10,12-14,16,23,28,33-36H,15,17H2,1-2H3 |
| InChIKey | RDPYULPVMWPUDK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|