C32H29F3N2O5 — CID 158907277
2-(cyclopropen-1-yl)-2-[[hydroxy-[5-[2-[2-(hydroxymethyl)-4-methoxyphenyl]ethynyl]-2-(trifluoromethoxy)phenyl]methyl]amino]-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 158907277) has the molecular formula C32H29F3N2O5 and a molecular weight of 578.59 g/mol. Its IUPAC name is 2-(cyclopropen-1-yl)-2-[[hydroxy-[5-[2-[2-(hydroxymethyl)-4-methoxyphenyl]ethynyl]-2-(trifluoromethoxy)phenyl]methyl]amino]-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | 2-(cyclopropen-1-yl)-2-[[hydroxy-[5-[2-[2-(hydroxymethyl)-4-methoxyphenyl]ethynyl]-2-(trifluoromethoxy)phenyl]methyl]amino]-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 158907277 |
| Molecular Formula | C32H29F3N2O5 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 2-(cyclopropen-1-yl)-2-[[hydroxy-[5-[2-[2-(hydroxymethyl)-4-methoxyphenyl]ethynyl]-2-(trifluoromethoxy)phenyl]methyl]amino]-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | COc1ccc(C#Cc2ccc(OC(F)(F)F)c(C(O)NC(CO)(Cc3c[nH]c4ccccc34)C3=CC3)c2)c(CO)c1 |
| InChI | InChI=1S/C32H29F3N2O5/c1-41-25-12-9-21(22(15-25)18-38)8-6-20-7-13-29(42-32(33,34)35)27(14-20)30(40)37-31(19-39,24-10-11-24)16-23-17-36-28-5-3-2-4-26(23)28/h2-5,7,9-10,12-15,17,30,36-40H,11,16,18-19H2,1H3 |
| InChIKey | JGEWXCYZPGVNLE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|