C28H27FN2O2 — CID 143762032
2-amino-2-[5-[2-(2,6-dimethylphenyl)ethynyl]-2-(fluoromethoxy)phenyl]-3-(1H-indol-3-yl)propan-1-ol (PubChem CID 143762032) has the molecular formula C28H27FN2O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-amino-2-[5-[2-(2,6-dimethylphenyl)ethynyl]-2-(fluoromethoxy)phenyl]-3-(1H-indol-3-yl)propan-1-ol.
| Compound Name | 2-amino-2-[5-[2-(2,6-dimethylphenyl)ethynyl]-2-(fluoromethoxy)phenyl]-3-(1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 143762032 |
| Molecular Formula | C28H27FN2O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-amino-2-[5-[2-(2,6-dimethylphenyl)ethynyl]-2-(fluoromethoxy)phenyl]-3-(1H-indol-3-yl)propan-1-ol |
| SMILES | Cc1cccc(C)c1C#Cc1ccc(OCF)c(C(N)(CO)Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C28H27FN2O2/c1-19-6-5-7-20(2)23(19)12-10-21-11-13-27(33-18-29)25(14-21)28(30,17-32)15-22-16-31-26-9-4-3-8-24(22)26/h3-9,11,13-14,16,31-32H,15,17-18,30H2,1-2H3 |
| InChIKey | DCNGNRHLNSCMAJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|