C28H28N2O2 — CID 143762025
2-[[[1-hydroxy-3-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]methyl]-4-[2-(4-methylphenyl)ethynyl]phenol (PubChem CID 143762025) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[[[1-hydroxy-3-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]methyl]-4-[2-(4-methylphenyl)ethynyl]phenol.
| Compound Name | 2-[[[1-hydroxy-3-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]methyl]-4-[2-(4-methylphenyl)ethynyl]phenol |
|---|---|
| PubChem CID | 143762025 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[[[1-hydroxy-3-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]methyl]-4-[2-(4-methylphenyl)ethynyl]phenol |
| SMILES | Cc1ccc(C#Cc2ccc(O)c(CNC(C)(CO)Cc3c[nH]c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C28H28N2O2/c1-20-7-9-21(10-8-20)11-12-22-13-14-27(32)23(15-22)18-30-28(2,19-31)16-24-17-29-26-6-4-3-5-25(24)26/h3-10,13-15,17,29-32H,16,18-19H2,1-2H3 |
| InChIKey | NGJRSXGQVUSSDT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|