C18H14ClFO — CID 143762424
8-(6-chloro-2-fluoro-3-methylphenyl)-5,6-dihydronaphthalene-2-carbaldehyde (PubChem CID 143762424) has the molecular formula C18H14ClFO and a molecular weight of 300.76 g/mol. Its IUPAC name is 8-(6-chloro-2-fluoro-3-methylphenyl)-5,6-dihydronaphthalene-2-carbaldehyde.
| Compound Name | 8-(6-chloro-2-fluoro-3-methylphenyl)-5,6-dihydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 143762424 |
| Molecular Formula | C18H14ClFO |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 8-(6-chloro-2-fluoro-3-methylphenyl)-5,6-dihydronaphthalene-2-carbaldehyde |
| SMILES | Cc1ccc(Cl)c(C2=CCCc3ccc(C=O)cc32)c1F |
| InChI | InChI=1S/C18H14ClFO/c1-11-5-8-16(19)17(18(11)20)14-4-2-3-13-7-6-12(10-21)9-15(13)14/h4-10H,2-3H2,1H3 |
| InChIKey | PSGZOUWDQQVPAH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|