C30H41NO2 — CID 143766318
methylcyclopropane;[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazol-3-yl]-(3-prop-2-enylcyclobutyl)methanone (PubChem CID 143766318) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is methylcyclopropane;[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazol-3-yl]-(3-prop-2-enylcyclobutyl)methanone.
| Compound Name | methylcyclopropane;[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazol-3-yl]-(3-prop-2-enylcyclobutyl)methanone |
|---|---|
| PubChem CID | 143766318 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | methylcyclopropane;[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazol-3-yl]-(3-prop-2-enylcyclobutyl)methanone |
| SMILES | C=CCC1CC(C(=O)c2ccc3c(c2)c2c(n3C)CCC(C3CCOCC3)C2)C1.CC1CC1 |
| InChI | InChI=1S/C26H33NO2.C4H8/c1-3-4-17-13-21(14-17)26(28)20-6-8-25-23(16-20)22-15-19(5-7-24(22)27(25)2)18-9-11-29-12-10-18;1-4-2-3-4/h3,6,8,16-19,21H,1,4-5,7,9-15H2,2H3;4H,2-3H2,1H3 |
| InChIKey | GAZDIWAHYNIDJJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|