C26H34F3N3O4S — CID 143766370
N-ethyl-9-ethylsulfinyl-6-(oxan-4-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 143766370) has the molecular formula C26H34F3N3O4S and a molecular weight of 541.64 g/mol. Its IUPAC name is N-ethyl-9-ethylsulfinyl-6-(oxan-4-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-ethyl-9-ethylsulfinyl-6-(oxan-4-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 143766370 |
| Molecular Formula | C26H34F3N3O4S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-ethyl-9-ethylsulfinyl-6-(oxan-4-yl)-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CCN(CC(=O)NCC(F)(F)F)C(=O)c1ccc2c(c1)c1c(n2S(=O)CC)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C26H34F3N3O4S/c1-3-31(15-24(33)30-16-26(27,28)29)25(34)19-6-8-23-21(14-19)20-13-18(17-9-11-36-12-10-17)5-7-22(20)32(23)37(35)4-2/h6,8,14,17-18H,3-5,7,9-13,15-16H2,1-2H3,(H,30,33) |
| InChIKey | VVWJJHURPPYEKR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |