C27H50O4Si — CID 14376746
(E)-1-[(2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-yl]oct-1-en-3-one (PubChem CID 14376746) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is (E)-1-[(2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-yl]oct-1-en-3-one.
| Compound Name | (E)-1-[(2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-yl]oct-1-en-3-one |
|---|---|
| PubChem CID | 14376746 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | (E)-1-[(2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-yl]oct-1-en-3-one |
| SMILES | CCCCCC(=O)/C=C/C1=C(C)O[C@@H](OC)[C@@H]1CCCCCCCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H50O4Si/c1-7-11-15-18-24(28)20-21-25-23(5)31-27(29-6)26(25)19-16-13-12-14-17-22-30-32(8-2,9-3)10-4/h20-21,26-27H,7-19,22H2,1-6H3/b21-20+/t26-,27-/m1/s1 |
| InChIKey | AMVGFFVKEPAJCB-DBBLRDEYSA-N |
| XLogP | 7.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|