C20H38O4Si — CID 14332135
(2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-carbaldehyde (PubChem CID 14332135) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-carbaldehyde.
| Compound Name | (2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 14332135 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (2R,3R)-2-methoxy-5-methyl-3-(7-triethylsilyloxyheptyl)-2,3-dihydrofuran-4-carbaldehyde |
| SMILES | CC[Si](CC)(CC)OCCCCCCC[C@@H]1C(C=O)=C(C)O[C@H]1OC |
| InChI | InChI=1S/C20H38O4Si/c1-6-25(7-2,8-3)23-15-13-11-9-10-12-14-18-19(16-21)17(4)24-20(18)22-5/h16,18,20H,6-15H2,1-5H3/t18-,20-/m1/s1 |
| InChIKey | AVMJBZNEIVDXTC-UYAOXDASSA-N |
| XLogP | 5.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|