C25H48O4Si — CID 10388549
(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-heptylcyclohexene-1-carbaldehyde (PubChem CID 10388549) has the molecular formula C25H48O4Si and a molecular weight of 440.74 g/mol. Its IUPAC name is (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-heptylcyclohexene-1-carbaldehyde.
| Compound Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-heptylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10388549 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-heptylcyclohexene-1-carbaldehyde |
| SMILES | CCCCCCCC1=C(C=O)[C@H](C(OCC)OCC)[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H48O4Si/c1-9-12-13-14-15-16-20-17-18-22(29-30(7,8)25(4,5)6)23(21(20)19-26)24(27-10-2)28-11-3/h19,22-24H,9-18H2,1-8H3/t22-,23-/m0/s1 |
| InChIKey | PRKWCGVVPHWFJA-GOTSBHOMSA-N |
| XLogP | 7.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|