C20H36O4 — CID 10359934
(5S,6S)-6-(diethoxymethyl)-5-hydroxy-2-octylcyclohexene-1-carbaldehyde (PubChem CID 10359934) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (5S,6S)-6-(diethoxymethyl)-5-hydroxy-2-octylcyclohexene-1-carbaldehyde.
| Compound Name | (5S,6S)-6-(diethoxymethyl)-5-hydroxy-2-octylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10359934 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (5S,6S)-6-(diethoxymethyl)-5-hydroxy-2-octylcyclohexene-1-carbaldehyde |
| SMILES | CCCCCCCCC1=C(C=O)[C@H](C(OCC)OCC)[C@@H](O)CC1 |
| InChI | InChI=1S/C20H36O4/c1-4-7-8-9-10-11-12-16-13-14-18(22)19(17(16)15-21)20(23-5-2)24-6-3/h15,18-20,22H,4-14H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | DUAKGZKDRJKLHQ-OALUTQOASA-N |
| XLogP | 4.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|