C22H42O4Si — CID 10386182
(5S,6S)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)cyclohexene-1-carbaldehyde (PubChem CID 10386182) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (5S,6S)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)cyclohexene-1-carbaldehyde.
| Compound Name | (5S,6S)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10386182 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (5S,6S)-2-butyl-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)cyclohexene-1-carbaldehyde |
| SMILES | CCCCC1=C(C=O)[C@H](C(OCC)OCC)[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H42O4Si/c1-9-12-13-17-14-15-19(26-27(7,8)22(4,5)6)20(18(17)16-23)21(24-10-2)25-11-3/h16,19-21H,9-15H2,1-8H3/t19-,20-/m0/s1 |
| InChIKey | JODQJVRVWMFNRT-PMACEKPBSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|