C19H36O4Si — CID 10428368
(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-methylcyclohexene-1-carbaldehyde (PubChem CID 10428368) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-methylcyclohexene-1-carbaldehyde.
| Compound Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-methylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10428368 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(diethoxymethyl)-2-methylcyclohexene-1-carbaldehyde |
| SMILES | CCOC(OCC)[C@H]1C(C=O)=C(C)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-9-21-18(22-10-2)17-15(13-20)14(3)11-12-16(17)23-24(7,8)19(4,5)6/h13,16-18H,9-12H2,1-8H3/t16-,17-/m0/s1 |
| InChIKey | JOFPDWMXFWGTNE-IRXDYDNUSA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|