C15H24O5 — CID 10859031
[(1R,2R)-2-(diethoxymethyl)-3-formyl-4-methylcyclohex-3-en-1-yl] acetate (PubChem CID 10859031) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(1R,2R)-2-(diethoxymethyl)-3-formyl-4-methylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2R)-2-(diethoxymethyl)-3-formyl-4-methylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 10859031 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(1R,2R)-2-(diethoxymethyl)-3-formyl-4-methylcyclohex-3-en-1-yl] acetate |
| SMILES | CCOC(OCC)[C@@H]1C(C=O)=C(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O5/c1-5-18-15(19-6-2)14-12(9-16)10(3)7-8-13(14)20-11(4)17/h9,13-15H,5-8H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | WUXMBQZZANJTOG-ZIAGYGMSSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|