C26H31N3O4 — CID 143768142
N-(4-ethylphenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide;N-(oxan-2-yloxy)formamide (PubChem CID 143768142) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide;N-(oxan-2-yloxy)formamide.
| Compound Name | N-(4-ethylphenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide;N-(oxan-2-yloxy)formamide |
|---|---|
| PubChem CID | 143768142 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-(4-ethylphenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide;N-(oxan-2-yloxy)formamide |
| SMILES | CCc1ccc(NC(=O)c2cn3c4c(cccc24)CCC3)cc1.O=CNOC1CCCCO1 |
| InChI | InChI=1S/C20H20N2O.C6H11NO3/c1-2-14-8-10-16(11-9-14)21-20(23)18-13-22-12-4-6-15-5-3-7-17(18)19(15)22;8-5-7-10-6-3-1-2-4-9-6/h3,5,7-11,13H,2,4,6,12H2,1H3,(H,21,23);5-6H,1-4H2,(H,7,8) |
| InChIKey | IACFCWBJKNKLKI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|