C24H33N3O4 — CID 59535534
N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide (PubChem CID 59535534) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide.
| Compound Name | N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 59535534 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[7-(oxan-2-yloxyamino)-7-oxoheptyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)c1cc2cccc3c2n1CCC3)NOC1CCCCO1 |
| InChI | InChI=1S/C24H33N3O4/c28-21(26-31-22-13-4-6-16-30-22)12-3-1-2-5-14-25-24(29)20-17-19-10-7-9-18-11-8-15-27(20)23(18)19/h7,9-10,17,22H,1-6,8,11-16H2,(H,25,29)(H,26,28) |
| InChIKey | HZXSQCVQBBEERD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|