C19H22N2O4 — CID 95285310
N-[3-[[(2R)-oxan-2-yl]oxyamino]-3-oxopropyl]naphthalene-2-carboxamide (PubChem CID 95285310) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is N-[3-[[(2R)-oxan-2-yl]oxyamino]-3-oxopropyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[[(2R)-oxan-2-yl]oxyamino]-3-oxopropyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 95285310 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[3-[[(2R)-oxan-2-yl]oxyamino]-3-oxopropyl]naphthalene-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccc2ccccc2c1)NO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C19H22N2O4/c22-17(21-25-18-7-3-4-12-24-18)10-11-20-19(23)16-9-8-14-5-1-2-6-15(14)13-16/h1-2,5-6,8-9,13,18H,3-4,7,10-12H2,(H,20,23)(H,21,22)/t18-/m1/s1 |
| InChIKey | VLYVNFJLKVSXPF-GOSISDBHSA-N |
| XLogP | 2.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|