C17H18BrNO4 — CID 60612212
2-(6-bromonaphthalen-2-yl)oxy-N-(oxan-2-yloxy)acetamide (PubChem CID 60612212) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is 2-(6-bromonaphthalen-2-yl)oxy-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-(6-bromonaphthalen-2-yl)oxy-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 60612212 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-(6-bromonaphthalen-2-yl)oxy-N-(oxan-2-yloxy)acetamide |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1)NOC1CCCCO1 |
| InChI | InChI=1S/C17H18BrNO4/c18-14-6-4-13-10-15(7-5-12(13)9-14)22-11-16(20)19-23-17-3-1-2-8-21-17/h4-7,9-10,17H,1-3,8,11H2,(H,19,20) |
| InChIKey | SWWNOXCULOTYKS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|