C16H10IO5P — CID 143768293
3-(1,3-benzodioxol-5-yl)-7-iodophosphanyloxychromen-4-one (PubChem CID 143768293) has the molecular formula C16H10IO5P and a molecular weight of 440.13 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-iodophosphanyloxychromen-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7-iodophosphanyloxychromen-4-one |
|---|---|
| PubChem CID | 143768293 |
| Molecular Formula | C16H10IO5P |
| Molecular Weight | 440.13 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-iodophosphanyloxychromen-4-one |
| SMILES | O=c1c(-c2ccc3c(c2)OCO3)coc2cc(OPI)ccc12 |
| InChI | InChI=1S/C16H10IO5P/c17-23-22-10-2-3-11-14(6-10)19-7-12(16(11)18)9-1-4-13-15(5-9)21-8-20-13/h1-7,23H,8H2 |
| InChIKey | YPERPSMQERJKBY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.13 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|