About ethane;2-ethyl-2,6-dimethylpiperidine
ethane;2-ethyl-2,6-dimethylpiperidine (PubChem CID 143770628) has the molecular formula C13H31N
and a molecular weight of 201.40 g/mol. Its IUPAC name is ethane;2-ethyl-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | ethane;2-ethyl-2,6-dimethylpiperidine |
| PubChem CID | 143770628 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | ethane;2-ethyl-2,6-dimethylpiperidine |
| SMILES | CC.CC.CCC1(C)CCCC(C)N1 |
| InChI | InChI=1S/C9H19N.2C2H6/c1-4-9(3)7-5-6-8(2)10-9;2*1-2/h8,10H,4-7H2,1-3H3;2*1-2H3 |
| InChIKey | CPYDXTOFTURKJP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethyl-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-2,6-dimethylpiperidine?
The IUPAC name of ethane;2-ethyl-2,6-dimethylpiperidine (CID 143770628) is ethane;2-ethyl-2,6-dimethylpiperidine.
What is the SMILES notation for ethane;2-ethyl-2,6-dimethylpiperidine?
The canonical SMILES for ethane;2-ethyl-2,6-dimethylpiperidine is CC.CC.CCC1(C)CCCC(C)N1.
What is the InChIKey of ethane;2-ethyl-2,6-dimethylpiperidine?
The InChIKey is CPYDXTOFTURKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.2C2H6/c1-4-9(3)7-5-6-8(2)10-9;2*1-2/h8,10H,4-7H2,1-3H3;2*1-2H3.
What are the key properties of ethane;2-ethyl-2,6-dimethylpiperidine?
ethane;2-ethyl-2,6-dimethylpiperidine has a molecular weight of 201.40 g/mol, XLogP of 4.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-2,6-dimethylpiperidine is sourced from PubChem (CID 143770628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).