C22H27NO — CID 143773476
1-(5-benzyl-3-methyl-1H-indol-2-yl)butan-1-one;ethane (PubChem CID 143773476) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-(5-benzyl-3-methyl-1H-indol-2-yl)butan-1-one;ethane.
| Compound Name | 1-(5-benzyl-3-methyl-1H-indol-2-yl)butan-1-one;ethane |
|---|---|
| PubChem CID | 143773476 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-(5-benzyl-3-methyl-1H-indol-2-yl)butan-1-one;ethane |
| SMILES | CC.CCCC(=O)c1[nH]c2ccc(Cc3ccccc3)cc2c1C |
| InChI | InChI=1S/C20H21NO.C2H6/c1-3-7-19(22)20-14(2)17-13-16(10-11-18(17)21-20)12-15-8-5-4-6-9-15;1-2/h4-6,8-11,13,21H,3,7,12H2,1-2H3;1-2H3 |
| InChIKey | DNKSJXQLHIVARM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|