C36H50ClNO2 — CID 143776060
(2R)-2-(4-chloro-3-methylphenyl)-2-methyl-6-[4-[(2-oxocyclohexyl)methyl]cyclohexyl]-N-[(1R)-1-phenylpropyl]hexanamide (PubChem CID 143776060) has the molecular formula C36H50ClNO2 and a molecular weight of 564.25 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-methylphenyl)-2-methyl-6-[4-[(2-oxocyclohexyl)methyl]cyclohexyl]-N-[(1R)-1-phenylpropyl]hexanamide.
| Compound Name | (2R)-2-(4-chloro-3-methylphenyl)-2-methyl-6-[4-[(2-oxocyclohexyl)methyl]cyclohexyl]-N-[(1R)-1-phenylpropyl]hexanamide |
|---|---|
| PubChem CID | 143776060 |
| Molecular Formula | C36H50ClNO2 |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | (2R)-2-(4-chloro-3-methylphenyl)-2-methyl-6-[4-[(2-oxocyclohexyl)methyl]cyclohexyl]-N-[(1R)-1-phenylpropyl]hexanamide |
| SMILES | CC[C@@H](NC(=O)[C@](C)(CCCCC1CCC(CC2CCCCC2=O)CC1)c1ccc(Cl)c(C)c1)c1ccccc1 |
| InChI | InChI=1S/C36H50ClNO2/c1-4-33(29-13-6-5-7-14-29)38-35(40)36(3,31-21-22-32(37)26(2)24-31)23-11-10-12-27-17-19-28(20-18-27)25-30-15-8-9-16-34(30)39/h5-7,13-14,21-22,24,27-28,30,33H,4,8-12,15-20,23,25H2,1-3H3,(H,38,40)/t27?,28?,30?,33-,36-/m1/s1 |
| InChIKey | BBNAAALLJHCVER-CMMWCMEESA-N |
| XLogP | 9.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|