C20H40N4O — CID 143776516
1-cyclohexyl-1-[1-(4-methylpiperidin-4-yl)piperidin-4-yl]urea;ethane (PubChem CID 143776516) has the molecular formula C20H40N4O and a molecular weight of 352.57 g/mol. Its IUPAC name is 1-cyclohexyl-1-[1-(4-methylpiperidin-4-yl)piperidin-4-yl]urea;ethane.
| Compound Name | 1-cyclohexyl-1-[1-(4-methylpiperidin-4-yl)piperidin-4-yl]urea;ethane |
|---|---|
| PubChem CID | 143776516 |
| Molecular Formula | C20H40N4O |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | 1-cyclohexyl-1-[1-(4-methylpiperidin-4-yl)piperidin-4-yl]urea;ethane |
| SMILES | CC.CC1(N2CCC(N(C(N)=O)C3CCCCC3)CC2)CCNCC1 |
| InChI | InChI=1S/C18H34N4O.C2H6/c1-18(9-11-20-12-10-18)21-13-7-16(8-14-21)22(17(19)23)15-5-3-2-4-6-15;1-2/h15-16,20H,2-14H2,1H3,(H2,19,23);1-2H3 |
| InChIKey | VXOISHTXVLJVOH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |