C23H38N4O3 — CID 143776520
but-2-ynyl 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate (PubChem CID 143776520) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is but-2-ynyl 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate.
| Compound Name | but-2-ynyl 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143776520 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | but-2-ynyl 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC#CCOC(=O)N1CCC(C)(N2CCC(N(C(N)=O)C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C23H38N4O3/c1-3-4-18-30-22(29)25-16-12-23(2,13-17-25)26-14-10-20(11-15-26)27(21(24)28)19-8-6-5-7-9-19/h19-20H,5-18H2,1-2H3,(H2,24,28) |
| InChIKey | QZAOWBIXZGSSKZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|