C13H24N3O2- — CID 143776657
1-[[4-[(2R)-4-hydroxybutan-2-yl]piperidine-1-carbonyl]amino]propylideneazanide (PubChem CID 143776657) has the molecular formula C13H24N3O2- and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-[[4-[(2R)-4-hydroxybutan-2-yl]piperidine-1-carbonyl]amino]propylideneazanide.
| Compound Name | 1-[[4-[(2R)-4-hydroxybutan-2-yl]piperidine-1-carbonyl]amino]propylideneazanide |
|---|---|
| PubChem CID | 143776657 |
| Molecular Formula | C13H24N3O2- |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-[[4-[(2R)-4-hydroxybutan-2-yl]piperidine-1-carbonyl]amino]propylideneazanide |
| SMILES | CCC(=[N-])NC(=O)N1CCC([C@H](C)CCO)CC1 |
| InChI | InChI=1S/C13H24N3O2/c1-3-12(14)15-13(18)16-7-4-11(5-8-16)10(2)6-9-17/h10-11,17H,3-9H2,1-2H3,(H-,14,15,18)/q-1/t10-/m1/s1 |
| InChIKey | IINOEDCMRYDVHL-SNVBAGLBSA-N |
| XLogP | 1.80 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|