C10H20O4P2S2 — CID 143777829
2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 143777829) has the molecular formula C10H20O4P2S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 143777829 |
| Molecular Formula | C10H20O4P2S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(SSP2OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C10H20O4P2S2/c1-9(2)5-11-15(12-6-9)17-18-16-13-7-10(3,4)8-14-16/h5-8H2,1-4H3 |
| InChIKey | JWJOYLFEXPMCDZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|