C14H21NO3S — CID 143778792
5-(2,3-dimethylbutan-2-ylsulfanyl)-6,7-dihydro-4H-furo[3,2-c]pyridine-2-carboxylic acid (PubChem CID 143778792) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 5-(2,3-dimethylbutan-2-ylsulfanyl)-6,7-dihydro-4H-furo[3,2-c]pyridine-2-carboxylic acid.
| Compound Name | 5-(2,3-dimethylbutan-2-ylsulfanyl)-6,7-dihydro-4H-furo[3,2-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 143778792 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-(2,3-dimethylbutan-2-ylsulfanyl)-6,7-dihydro-4H-furo[3,2-c]pyridine-2-carboxylic acid |
| SMILES | CC(C)C(C)(C)SN1CCc2oc(C(=O)O)cc2C1 |
| InChI | InChI=1S/C14H21NO3S/c1-9(2)14(3,4)19-15-6-5-11-10(8-15)7-12(18-11)13(16)17/h7,9H,5-6,8H2,1-4H3,(H,16,17) |
| InChIKey | MBGPKWRJUXKANM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|