4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid

C10H12O3 — CID 82409161

IUPAC4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid
SMILESCC1CCCc2oc(C(=O)O)cc21
InChIInChI=1S/C10H12O3/c1-6-3-2-4-8-7(6)5-9(13-8)10(11)12/h5-6H,2-4H2,1H3,(H,11,12)
InChIKeyXFAJTIYFGKOOFV-UHFFFAOYSA-N
MW180.20 g/mol
LogP2.42
Rot. Bonds1

About 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid

4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid (PubChem CID 82409161) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid.

Molecular Properties

Compound Name4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid
PubChem CID82409161
Molecular FormulaC10H12O3
Molecular Weight180.20 g/mol
Exact Mass180.08
IUPAC Name4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid
SMILESCC1CCCc2oc(C(=O)O)cc21
InChIInChI=1S/C10H12O3/c1-6-3-2-4-8-7(6)5-9(13-8)10(11)12/h5-6H,2-4H2,1H3,(H,11,12)
InChIKeyXFAJTIYFGKOOFV-UHFFFAOYSA-N
XLogP2.42
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid?
The IUPAC name of 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid (CID 82409161) is 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid is CC1CCCc2oc(C(=O)O)cc21.
What is the InChIKey of 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid?
The InChIKey is XFAJTIYFGKOOFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-3-2-4-8-7(6)5-9(13-8)10(11)12/h5-6H,2-4H2,1H3,(H,11,12).
What are the key properties of 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid?
4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid has a molecular weight of 180.20 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 82409161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).