C23H23BrN4 — CID 143779104
2-bromo-1-N-[2-(1H-indol-3-yl)ethyl]-5-methyl-4-N-(2-methyl-4-pyridinyl)benzene-1,4-diamine (PubChem CID 143779104) has the molecular formula C23H23BrN4 and a molecular weight of 435.37 g/mol. Its IUPAC name is 2-bromo-1-N-[2-(1H-indol-3-yl)ethyl]-5-methyl-4-N-(2-methyl-4-pyridinyl)benzene-1,4-diamine.
| Compound Name | 2-bromo-1-N-[2-(1H-indol-3-yl)ethyl]-5-methyl-4-N-(2-methyl-4-pyridinyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 143779104 |
| Molecular Formula | C23H23BrN4 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-bromo-1-N-[2-(1H-indol-3-yl)ethyl]-5-methyl-4-N-(2-methyl-4-pyridinyl)benzene-1,4-diamine |
| SMILES | Cc1cc(Nc2cc(Br)c(NCCc3c[nH]c4ccccc34)cc2C)ccn1 |
| InChI | InChI=1S/C23H23BrN4/c1-15-11-23(20(24)13-22(15)28-18-8-10-25-16(2)12-18)26-9-7-17-14-27-21-6-4-3-5-19(17)21/h3-6,8,10-14,26-27H,7,9H2,1-2H3,(H,25,28) |
| InChIKey | TYCZGVVLOVTBRO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|