C12H22N2 — CID 143779686
ethane;[(E)-2-ethenylpent-2-enyl]-ethylcyanamide (PubChem CID 143779686) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;[(E)-2-ethenylpent-2-enyl]-ethylcyanamide.
| Compound Name | ethane;[(E)-2-ethenylpent-2-enyl]-ethylcyanamide |
|---|---|
| PubChem CID | 143779686 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;[(E)-2-ethenylpent-2-enyl]-ethylcyanamide |
| SMILES | C=C/C(=C\CC)CN(C#N)CC.CC |
| InChI | InChI=1S/C10H16N2.C2H6/c1-4-7-10(5-2)8-12(6-3)9-11;1-2/h5,7H,2,4,6,8H2,1,3H3;1-2H3/b10-7+; |
| InChIKey | CVFDLJMODPWULN-HCUGZAAXSA-N |
| XLogP | 3.34 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|