C23H17NO3 — CID 143780380
4-methyl-3-[(9-methylidenefluorene-1-carbonyl)amino]benzoic acid (PubChem CID 143780380) has the molecular formula C23H17NO3 and a molecular weight of 355.39 g/mol. Its IUPAC name is 4-methyl-3-[(9-methylidenefluorene-1-carbonyl)amino]benzoic acid.
| Compound Name | 4-methyl-3-[(9-methylidenefluorene-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 143780380 |
| Molecular Formula | C23H17NO3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-methyl-3-[(9-methylidenefluorene-1-carbonyl)amino]benzoic acid |
| SMILES | C=C1c2ccccc2-c2cccc(C(=O)Nc3cc(C(=O)O)ccc3C)c21 |
| InChI | InChI=1S/C23H17NO3/c1-13-10-11-15(23(26)27)12-20(13)24-22(25)19-9-5-8-18-17-7-4-3-6-16(17)14(2)21(18)19/h3-12H,2H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | IYYZSQXASNYVTD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |