C25H27N3O4S — CID 143780817
1-[3-tert-butyl-4-methoxy-5-[3-[(methylsulfanylamino)methyl]-1-benzofuran-6-yl]phenyl]pyrimidine-2,4-dione (PubChem CID 143780817) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 1-[3-tert-butyl-4-methoxy-5-[3-[(methylsulfanylamino)methyl]-1-benzofuran-6-yl]phenyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-tert-butyl-4-methoxy-5-[3-[(methylsulfanylamino)methyl]-1-benzofuran-6-yl]phenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143780817 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-[3-tert-butyl-4-methoxy-5-[3-[(methylsulfanylamino)methyl]-1-benzofuran-6-yl]phenyl]pyrimidine-2,4-dione |
| SMILES | COc1c(-c2ccc3c(CNSC)coc3c2)cc(-n2ccc(=O)[nH]c2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C25H27N3O4S/c1-25(2,3)20-12-17(28-9-8-22(29)27-24(28)30)11-19(23(20)31-4)15-6-7-18-16(13-26-33-5)14-32-21(18)10-15/h6-12,14,26H,13H2,1-5H3,(H,27,29,30) |
| InChIKey | HVBYJDDMUDJZGN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|