C17H19N3O3S — CID 90291636
1-[3-tert-butyl-4-methoxy-5-[2-(sulfanylamino)ethynyl]phenyl]pyrimidine-2,4-dione (PubChem CID 90291636) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[3-tert-butyl-4-methoxy-5-[2-(sulfanylamino)ethynyl]phenyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-tert-butyl-4-methoxy-5-[2-(sulfanylamino)ethynyl]phenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90291636 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[3-tert-butyl-4-methoxy-5-[2-(sulfanylamino)ethynyl]phenyl]pyrimidine-2,4-dione |
| SMILES | COc1c(C#CNS)cc(-n2ccc(=O)[nH]c2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C17H19N3O3S/c1-17(2,3)13-10-12(20-8-6-14(21)19-16(20)22)9-11(5-7-18-24)15(13)23-4/h6,8-10,18,24H,1-4H3,(H,19,21,22) |
| InChIKey | VOODUVYEFRGKDN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|