C23H23N3O5 — CID 67066440
1-[3-tert-butyl-4-methoxy-5-[2-(4-nitrophenyl)ethenyl]phenyl]pyrimidine-2,4-dione (PubChem CID 67066440) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 1-[3-tert-butyl-4-methoxy-5-[2-(4-nitrophenyl)ethenyl]phenyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-tert-butyl-4-methoxy-5-[2-(4-nitrophenyl)ethenyl]phenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67066440 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-[3-tert-butyl-4-methoxy-5-[2-(4-nitrophenyl)ethenyl]phenyl]pyrimidine-2,4-dione |
| SMILES | COc1c(C=Cc2ccc([N+](=O)[O-])cc2)cc(-n2ccc(=O)[nH]c2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C23H23N3O5/c1-23(2,3)19-14-18(25-12-11-20(27)24-22(25)28)13-16(21(19)31-4)8-5-15-6-9-17(10-7-15)26(29)30/h5-14H,1-4H3,(H,24,27,28) |
| InChIKey | MYHSNWCXTPDYEA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|