About methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate
methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate (PubChem CID 67066448) has the molecular formula C25H25N3O7
and a molecular weight of 479.49 g/mol. Its IUPAC name is methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate.
Molecular Properties
| Compound Name | methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate |
| PubChem CID | 67066448 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1C=Cc1cc(-n2ccc(=O)[nH]c2=O)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C25H25N3O7/c1-25(2,3)20-14-18(27-11-10-21(29)26-24(27)31)12-16(22(20)34-4)7-6-15-8-9-17(28(32)33)13-19(15)23(30)35-5/h6-14H,1-5H3,(H,26,29,31) |
| InChIKey | BURXHSIPTOGTEU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate?
The IUPAC name of methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate (CID 67066448) is methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate.
What is the SMILES notation for methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate?
The canonical SMILES for methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate is COC(=O)c1cc([N+](=O)[O-])ccc1C=Cc1cc(-n2ccc(=O)[nH]c2=O)cc(C(C)(C)C)c1OC.
What is the InChIKey of methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate?
The InChIKey is BURXHSIPTOGTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O7/c1-25(2,3)20-14-18(27-11-10-21(29)26-24(27)31)12-16(22(20)34-4)7-6-15-8-9-17(28(32)33)13-19(15)23(30)35-5/h6-14H,1-5H3,(H,26,29,31).
What are the key properties of methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate?
methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate has a molecular weight of 479.49 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]ethenyl]-5-nitrobenzoate is sourced from PubChem (CID 67066448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).