C24H27N3Na2O5S — CID 67066265
CID 67066265 (PubChem CID 67066265) has the molecular formula C24H27N3Na2O5S and a molecular weight of 515.54 g/mol.
| Compound Name | CID 67066265 |
|---|---|
| PubChem CID | 67066265 |
| Molecular Formula | C24H27N3Na2O5S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | — |
| SMILES | COc1c(/C=C/c2ccc(NS(C)(=O)=O)cc2)cc(-n2ccc(=O)[nH]c2=O)cc1C(C)(C)C.[Na].[Na] |
| InChI | InChI=1S/C24H27N3O5S.2Na/c1-24(2,3)20-15-19(27-13-12-21(28)25-23(27)29)14-17(22(20)32-4)9-6-16-7-10-18(11-8-16)26-33(5,30)31;;/h6-15,26H,1-5H3,(H,25,28,29);;/b9-6+;; |
| InChIKey | ZLAGJEHVBCNXOA-SWSRPJROSA-N |
| XLogP | 2.61 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|