C23H24ClN3O4S — CID 25234726
N-[4-[(E)-2-[3-tert-butyl-2-chloro-5-(2,4-dioxopyrimidin-1-yl)phenyl]ethenyl]phenyl]methanesulfonamide (PubChem CID 25234726) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is N-[4-[(E)-2-[3-tert-butyl-2-chloro-5-(2,4-dioxopyrimidin-1-yl)phenyl]ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-2-[3-tert-butyl-2-chloro-5-(2,4-dioxopyrimidin-1-yl)phenyl]ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25234726 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[4-[(E)-2-[3-tert-butyl-2-chloro-5-(2,4-dioxopyrimidin-1-yl)phenyl]ethenyl]phenyl]methanesulfonamide |
| SMILES | CC(C)(C)c1cc(-n2ccc(=O)[nH]c2=O)cc(/C=C/c2ccc(NS(C)(=O)=O)cc2)c1Cl |
| InChI | InChI=1S/C23H24ClN3O4S/c1-23(2,3)19-14-18(27-12-11-20(28)25-22(27)29)13-16(21(19)24)8-5-15-6-9-17(10-7-15)26-32(4,30)31/h5-14,26H,1-4H3,(H,25,28,29)/b8-5+ |
| InChIKey | NQMWGEWHYNMNKP-VMPITWQZSA-N |
| XLogP | 4.02 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|