N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen

C9H19NO2 — CID 143781910

IUPACN-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen
SMILESC=CC(=O)NCCCCOCC.[H][H]
InChIInChI=1S/C9H17NO2.H2/c1-3-9(11)10-7-5-6-8-12-4-2;/h3H,1,4-8H2,2H3,(H,10,11);1H
InChIKeyDHXRTVGQHVIFGV-UHFFFAOYSA-N
MW173.26 g/mol
LogP1.35
Rot. Bonds7

About N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen

N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen (PubChem CID 143781910) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen.

Molecular Properties

Compound NameN-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen
PubChem CID143781910
Molecular FormulaC9H19NO2
Molecular Weight173.26 g/mol
Exact Mass173.14
IUPAC NameN-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen
SMILESC=CC(=O)NCCCCOCC.[H][H]
InChIInChI=1S/C9H17NO2.H2/c1-3-9(11)10-7-5-6-8-12-4-2;/h3H,1,4-8H2,2H3,(H,10,11);1H
InChIKeyDHXRTVGQHVIFGV-UHFFFAOYSA-N
XLogP1.35
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.26
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen?
The IUPAC name of N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen (CID 143781910) is N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen.
What is the SMILES notation for N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen?
The canonical SMILES for N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen is C=CC(=O)NCCCCOCC.[H][H].
What is the InChIKey of N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen?
The InChIKey is DHXRTVGQHVIFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.H2/c1-3-9(11)10-7-5-6-8-12-4-2;/h3H,1,4-8H2,2H3,(H,10,11);1H.
What are the key properties of N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen?
N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen has a molecular weight of 173.26 g/mol, XLogP of 1.35, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethoxybutyl)prop-2-enamide;molecular hydrogen is sourced from PubChem (CID 143781910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).