C23H33NO2 — CID 143782263
benzene;(2Z,4Z)-hepta-2,4-diene;2-[(2-hydroxyethylamino)methyl]-6-methylphenol (PubChem CID 143782263) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is benzene;(2Z,4Z)-hepta-2,4-diene;2-[(2-hydroxyethylamino)methyl]-6-methylphenol.
| Compound Name | benzene;(2Z,4Z)-hepta-2,4-diene;2-[(2-hydroxyethylamino)methyl]-6-methylphenol |
|---|---|
| PubChem CID | 143782263 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | benzene;(2Z,4Z)-hepta-2,4-diene;2-[(2-hydroxyethylamino)methyl]-6-methylphenol |
| SMILES | C/C=C\C=C/CC.Cc1cccc(CNCCO)c1O.c1ccccc1 |
| InChI | InChI=1S/C10H15NO2.C7H12.C6H6/c1-8-3-2-4-9(10(8)13)7-11-5-6-12;1-3-5-7-6-4-2;1-2-4-6-5-3-1/h2-4,11-13H,5-7H2,1H3;3,5-7H,4H2,1-2H3;1-6H/b;5-3-,7-6-; |
| InChIKey | XNUJDTCJWPTEID-RDYKFZKCSA-N |
| XLogP | 5.00 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|