C41H53N5O4S — CID 143782412
pyridin-4-ylmethyl N-[1-[[7-[(4-aminophenyl)sulfanyl-(3-methylbutyl)amino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 143782412) has the molecular formula C41H53N5O4S and a molecular weight of 711.97 g/mol. Its IUPAC name is pyridin-4-ylmethyl N-[1-[[7-[(4-aminophenyl)sulfanyl-(3-methylbutyl)amino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | pyridin-4-ylmethyl N-[1-[[7-[(4-aminophenyl)sulfanyl-(3-methylbutyl)amino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 143782412 |
| Molecular Formula | C41H53N5O4S |
| Molecular Weight | 711.97 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | pyridin-4-ylmethyl N-[1-[[7-[(4-aminophenyl)sulfanyl-(3-methylbutyl)amino]-8-hydroxyoctan-3-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | CCC(CCCC(CO)N(CCC(C)C)Sc1ccc(N)cc1)NC(=O)C(NC(=O)OCc1ccncc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H53N5O4S/c1-4-35(16-11-17-36(28-47)46(27-24-30(2)3)51-37-20-18-34(42)19-21-37)44-40(48)39(45-41(49)50-29-31-22-25-43-26-23-31)38(32-12-7-5-8-13-32)33-14-9-6-10-15-33/h5-10,12-15,18-23,25-26,30,35-36,38-39,47H,4,11,16-17,24,27-29,42H2,1-3H3,(H,44,48)(H,45,49) |
| InChIKey | HEGSUYYGOBSOAJ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.97 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|