C22H28FNO3 — CID 143782639
N-[5-(2-tert-butyl-4-hydroxyphenyl)pentyl]-3-fluoro-4-hydroxybenzamide (PubChem CID 143782639) has the molecular formula C22H28FNO3 and a molecular weight of 373.47 g/mol. Its IUPAC name is N-[5-(2-tert-butyl-4-hydroxyphenyl)pentyl]-3-fluoro-4-hydroxybenzamide.
| Compound Name | N-[5-(2-tert-butyl-4-hydroxyphenyl)pentyl]-3-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 143782639 |
| Molecular Formula | C22H28FNO3 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | N-[5-(2-tert-butyl-4-hydroxyphenyl)pentyl]-3-fluoro-4-hydroxybenzamide |
| SMILES | CC(C)(C)c1cc(O)ccc1CCCCCNC(=O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C22H28FNO3/c1-22(2,3)18-14-17(25)10-8-15(18)7-5-4-6-12-24-21(27)16-9-11-20(26)19(23)13-16/h8-11,13-14,25-26H,4-7,12H2,1-3H3,(H,24,27) |
| InChIKey | QNODPCPKYHJZHK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|